
CAS 27191-09-9: Anisidinehydrochloride
Formula:C7H10ClNO
InChI:InChI=1/C7H9NO.ClH/c1-9-7-4-2-3-6(8)5-7;/h2-5H,8H2,1H3;1H
SMILES:COc1cccc(c1)N.Cl
Synonyms:- m-Anisidine hydrochloride
- 3-Methoxyaniline Hydrochloride (1:1)
Sort by
Found 4 products.
3-Methoxyaniline hydrochloride
CAS:3-Methoxyaniline hydrochloridePurity:97+%Molecular weight:159.61g/molm-Anisidine Hydrochloride
CAS:m-Anisidine Hydrochloride is a quinoxaline that is a metabolite of aniline. It has been used in the synthesis of other compounds, such as the benzodiazepines and benzopyridazinones. m-Anisidine Hydrochloride is also known to have antimicrobial properties.Formula:C7H9NO·HClPurity:Min. 95%Molecular weight:159.61 g/mol3-Methoxyaniline hydrochloride
CAS:Formula:C7H10ClNOPurity:%Color and Shape:SolidMolecular weight:159.6134