
CAS 2753-74-4: 5-Ethyldihydro-5-phenyl-2-thioxo-4,6(1H,5H)-pyrimidinedione
Formula:C12H12N2O2S
InChI:InChI=1S/C12H12N2O2S/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17)
InChI key:InChIKey=GHHFRPRCYQNNDL-UHFFFAOYSA-N
SMILES:C(C)C1(C(=O)NC(=S)NC1=O)C2=CC=CC=C2
Synonyms:- 2-Thiophenobarbital
- 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-phenyl-2-thioxo-
- 5-Ethyl-5-phenyl-2-thiobarbituric acid
- 5-Ethyl-5-phenylthiobarbituric acid
- 5-Ethyldihydro-5-phenyl-2-thioxo-4,6(1H,5H)-pyrimidinedione
- 5-ethyl-5-phenyl-2-thioxodihydropyrimidine-4,6(1H,5H)-dione
- Barbituric acid, 5-ethyl-5-phenyl-2-thio-
- NSC 120809
- 5-Ethyldihydro-5-phenyl-2-thioxopyrimidine-4,6(1H,5H)-dione
Sort by
Found 2 products.
5-Phenyl-5-ethyl-2-thiobarbituric acid
CAS:5-Phenyl-5-ethyl-2-thiobarbituric acid is a molecule that has a molecular structure consisting of an asymmetric carbon atom. The molecule can exist in two enantiomers, which have the same chemical formula but differ in their three dimensional orientation. The two enantiomers can be distinguished by their different interactions with the cavity of beta cyclodextrin. 5-Phenyl-5-ethyl-2-thiobarbituric acid was found to interact with the beta cyclodextrin cavity in a catalytic manner, and this interaction was found to affect the rate of reaction between 5-phenyl-5-ethyl-2 thiobarbituric acid and hydrogen peroxide. This is because it leads to an increase in activation energy and absorbance values.Formula:C12H12N2O2SPurity:Min. 95%Molecular weight:248.3 g/molRef: 3D-FP26924
Discontinued product5-Phenyl-5-ethyl-2-thiobarbituric Acid
CAS:Controlled ProductFormula:C12H12N2O2SColor and Shape:NeatMolecular weight:248.3