![dibenzo[b,d]furan-4-carboxylic acid](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F321852-dibenzo-b-d-furan-4-carboxylic-acid.webp&w=3840&q=75)
CAS 2786-05-2: dibenzo[b,d]furan-4-carboxylic acid
Formula:C13H8O3
InChI:InChI=1/C13H8O3/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7H,(H,14,15)
SMILES:c1ccc2c(c1)c1cccc(c1o2)C(=O)O
Sort by
Found 3 products.
Dibenzofuran-4-Carboxylic Acid
CAS:Dibenzofuran-4-carboxylic acid is a naphthalene derivative that belongs to the class of polyaromatic compounds. It has been shown by X-ray diffraction techniques to form a crystalline solid with magnesium. Dibenzofuran-4-carboxylic acid inhibits tumour growth and has also been shown to be an inhibitor binding to the enzyme complementarity protein (CYP) in rat liver microsomes. This compound binds as a ligand to the CYP and modifies its activity, leading to an increase in the levels of cytotoxic agents such as adriamycin, daunomycin, and mitomycin C. Dibenzofuran-4-carboxylic acid can be used as an optical probe for studying stereospecific reactions.Formula:C13H8O3Purity:Min. 95%Molecular weight:212.2 g/mol4-Dibenzofurancarboxylic acid
CAS:Formula:C13H8O3Purity:95%Color and Shape:SolidMolecular weight:212.20082Dibenzo[b,d]furan-4-carboxylic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:212.20399475097656