
CAS 28199-69-1: Dihydrodehydrodiconiferyl alcohol
Formula:C20H24O6
InChI:InChI=1S/C20H24O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h5-6,8-10,15,19,21-23H,3-4,7,11H2,1-2H3/t15-,19+/m0/s1
InChI key:InChIKey=SBLZVJIHPWRSQQ-HNAYVOBHSA-N
SMILES:C(O)[C@H]1C=2C(O[C@@]1(C3=CC(OC)=C(O)C=C3)[H])=C(OC)C=C(CCCO)C2
Sort by
Found 5 products.
Dihydrodehydrodiconiferyl alcohol
CAS:Dihydrodehydrodiconiferyl alcoholPurity:≥95%Molecular weight:360.4g/molDihydrodehydrodiconiferyl alcohol
CAS:Dihydrodehydrodiconiferyl alcohol is the methanolic extract of Liriodendron tulipifera[1].Formula:C20H24O6Purity:96.50%Color and Shape:SolidMolecular weight:360.4Dihydrodehydrodiconiferyl alcohol
CAS:Dihydrodehydrodiconiferyl alcohol is a lignan compound, which is a type of polyphenol. It is primarily sourced from plants, including species like conifers and other woody plants. The compound is notable for its ability to modulate various biochemical pathways, primarily through its antioxidant and anti-inflammatory activities. Its mode of action involves scavenging free radicals and inhibiting pro-inflammatory enzyme pathways, thereby reducing oxidative stress and inflammation at the cellular level. Uses and applications of dihydrodehydrodiconiferyl alcohol are significant in scientific research, where it is utilized to explore its potential effects on cellular health, particularly its protective roles against oxidative damage. Ongoing studies are also investigating its potential therapeutic applications in chronic inflammatory conditions and diseases linked to oxidative stress. As research advances, its impact on signaling pathways and gene expression related to stress responses continues to be of high interest in the fields of pharmacology and biochemistry.Formula:C20H24O6Purity:Min. 95%Molecular weight:360.4 g/mol(2S,3R)-Dihydrodehydroconiferyl Alcohol
CAS:Controlled ProductFormula:C20H24O6Color and Shape:NeatMolecular weight:360.401