
CAS 2827-44-3: 6-ethoxy-1,3,5-triazine-2,4-diamine
Formula:C5H9N5O
InChI:InChI=1/C5H9N5O/c1-2-11-5-9-3(6)8-4(7)10-5/h2H2,1H3,(H4,6,7,8,9,10)
SMILES:CCOc1nc(=N)[nH]c(=N)[nH]1
Synonyms:- 1,3,5-Triazine-2,4-Diamine, 6-Ethoxy-
Sort by
Found 2 products.
2,4-Diamino-6-ethoxytriazine
CAS:2,4-Diamino-6-ethoxytriazine is a fine chemical that can be used as a building block in the synthesis of various organic compounds. The compound has been shown to react with other chemicals to form new compounds. 2,4-Diamino-6-ethoxytriazine is also used as a reagent and speciality chemical in research laboratories and as a reaction component or useful intermediate in the synthesis of various organic compounds. 2,4-Diamino-6-ethoxytriazine is versatile enough to serve as a scaffold for more complex molecules.Formula:C5H9N5OPurity:Min. 95%Color and Shape:SolidMolecular weight:155.16 g/mol