
CAS 28926-65-0: Tris(diphenylphosphino)methane
Formula:C37H31P3
InChI:InChI=1/C37H31P3/c1-7-19-31(20-8-1)38(32-21-9-2-10-22-32)37(39(33-23-11-3-12-24-33)34-25-13-4-14-26-34)40(35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30,37H
SMILES:c1ccc(cc1)P(c1ccccc1)C(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1
Synonyms:- 1,1,1-Tris(diphenylphosphino)methane
- Methanetriyltris(Diphenylphosphane)
Sort by
Found 3 products.
1,1,1-Tris(diphenylphosphino)methane
CAS:TPD is a bidentate ligand, which means it has two binding sites. It is often used in coordination chemistry because it is able to bind to metal ions and form complexes. TPD has been shown to be effective as a proton donor, which makes it useful for many chemical reactions. It has been used for the synthesis of metal carbonyls and nitrogen-containing compounds. TPD has also been studied by photophysical and x-ray crystallographic methods. This ligand can be used to study acid molecules and the functional theory of luminescence.Formula:C37H31P3Purity:Min. 95%Molecular weight:568.6 g/molPhosphine, P,P',P''-methylidynetris[diphenyl-
CAS:Formula:C37H31P3Purity:97%Molecular weight:568.56331,1,1-Tris(diphenylphosphino)methane, 97%
CAS:1,1,1-Tris(diphenylphosphino)methane, 97%Formula:HCP(C6H5)2Purity:97%Color and Shape:white xtl.Molecular weight:568.58