
CAS 2941-48-2: 2,5-Dichloro-1,3-benzothiazole
Formula:C7H3Cl2NS
InChI:InChI=1/C7H3Cl2NS/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H
SMILES:c1cc2c(cc1Cl)nc(Cl)s2
Synonyms:- Benzothiazole, 2,5-Dichloro-
- 2,5-Dichlorobenzo[d]thiazole
Sort by
Found 4 products.
2,5-Dichlorobenzothiazole
CAS:Formula:C7H3Cl2NSPurity:97%Color and Shape:SolidMolecular weight:204.07642,5-Dichlorobenzothiazole
CAS:2,5-Dichlorobenzothiazole is a heterocyclic organic compound that contains two benzene rings and one thiazole ring. The nitrogen atom in the heterocycle is adjacent to two carbons and two nitrogens. This substituent has a five-membered ring with two carbon atoms and one nitrogen atom. 2,5-Dichlorobenzothiazole is an effective fungicide that can be used to control diseases of plants caused by fungi such as Alternaria alternata, Botrytis cinerea, Cercospora beticola, Dactylium dendroides, Fusarium oxysporum and Phoma sp.Formula:C7H3NSCl2Purity:Min. 95%Molecular weight:204.08 g/mol2,5-Dichloro-1,3-benzothiazole
CAS:2,5-Dichloro-1,3-benzothiazolePurity:97+%Molecular weight:204.08g/mol