
CAS 2945-08-6: Methyl p-nitrophenylacetate
Formula:C9H9NO4
InChI:InChI=1/C9H9NO4/c1-14-9(11)6-7-2-4-8(5-3-7)10(12)13/h2-5H,6H2,1H3
SMILES:COC(=O)Cc1ccc(cc1)N(=O)=O
Synonyms:- Acetic acid, (p-nitrophenyl)-, methyl ester
- Benzeneacetic Acid, 4-Nitro-, Methyl Ester
- Methyl (4-nitrophenyl)acetate
Sort by
Found 4 products.
Methyl 2-(4-nitrophenyl)acetate
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:195.1739959716797Methyl 2-(4-nitrophenyl)acetate
CAS:Methyl 2-(4-nitrophenyl)acetate (MPAA) is an amide with a kinetic rate constant of 10.5 M-1 s-1. It is also a potent antitumor agent, with a kinetic constant of 5.2 M-1 s-1 and a molecular weight of 194.2 g/mol. MPAA has shown potential as an antitumor drug, but requires further research to determine its mechanism of action and cytotoxicity in cells. MPAA's synthesis begins with the reaction between benzaldehyde and ethyl diazoacetate, which forms the benzene ring in the molecule. A molecule such as this could be used for structural studies or as an antitumor drug due to its potent activity against cancer cells.Formula:C9H9NO4Purity:Min. 95%Molecular weight:195.17 g/molMethyl (4-nitrophenyl)acetate
CAS:Methyl (4-nitrophenyl)acetateFormula:C9H9NO4Purity:95Color and Shape: off-white solidMolecular weight:195.17g/molBenzeneacetic acid, 4-nitro-, methyl ester
CAS:Formula:C9H9NO4Purity:98%Color and Shape:SolidMolecular weight:195.17206