
CAS 294674-05-8: (+)-Ganoderic acid ε
Formula:C30H44O7
InChI:InChI=1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h11,15,17-19,21-22,31-32,34H,8-10,12-14H2,1-7H3,(H,36,37)/b16-11+/t15-,17+,18-,19+,21+,22+,28+,29-,30+/m1/s1
InChI key:InChIKey=MIWGXXQCEDNROQ-UZOYOLKESA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](C[C@@H](/C=C(/C(O)=O)\C)O)C)(CC2=O)[H]
Synonyms:- (+)-Ganoderic acid ε
- Lanosta-8,24-dien-26-oic acid, 3,7,23-trihydroxy-11,15-dioxo-, (3β,7β,23S,24E)-
- Ganoderic acid ε
- (3β,7β,23S,24E)-3,7,23-Trihydroxy-11,15-dioxolanosta-8,24-dien-26-oic acid
Sort by
Found 3 products.
Ganoderic acid epsilon
CAS:Controlled ProductGanoderic acid epsilon is a bioactive compound, which is a lanostane-type triterpene. It is sourced from the medicinal mushroom Ganoderma lucidum, commonly known as Reishi or Lingzhi, which has been used in traditional medicine for centuries. The mode of action of ganoderic acid epsilon involves the modulation of various cellular pathways, including anti-inflammatory, anti-tumor, and immunomodulatory effects. This compound can inhibit certain signaling pathways and enzymes involved in the proliferation and survival of cancer cells, making it a promising candidate for cancer therapy. In scientific research, ganoderic acid epsilon is studied for its potential applications in oncology and immunology, where its ability to induce apoptosis in cancer cells without harming normal cells is of particular interest. Additionally, it has applications in reducing inflammation and modulating immune responses, which could be beneficial in treating autoimmune diseases. As such, it is a subject of extensive study to unravel its full therapeutic potential and molecular mechanisms.Formula:C30H44O7Purity:Min. 95%Molecular weight:516.7 g/molGanoderic acid ε
CAS:Ganoderic acid ε, a naturally occurring terpenoid, is extracted from the Fungus Ganoderma lucidum.Formula:C30H44O7Color and Shape:SolidMolecular weight:516.675