
CAS 2990-02-5: 2,4-Dimethylphenylurea
Formula:C9H12N2O
InChI:InChI=1/C9H12N2O/c1-6-3-4-8(7(2)5-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12)
SMILES:Cc1ccc(c(C)c1)NC(=N)O
Synonyms:- 1-(2,4-Dimethylphenyl)Urea
Sort by
Found 4 products.
2,4-Dimethylphenylurea
CAS:2,4-Dimethylphenylurea (DMPU) is a benzene derivative that has been shown to form dimers in the crystal structure. The two-dimensional structure of DMPU is composed of hydrogen-bonded urea rings and benzene rings. The dihedral angle between these rings is approximately 90°. A hydrogen bond can be seen connecting one of the carbonyl oxygens from an urea ring to a carbonyl carbon from another urea ring. This bond stabilizes the molecule and prevents it from dissociating into its individual components.Formula:C9H12N2OPurity:Min. 95%Molecular weight:164.2 g/mol