
CAS 29921-41-3: 2-Chlorodiphenylmethane
Formula:C13H11Cl
InChI:InChI=1/C13H11Cl/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9H,10H2
Synonyms:- Benzene, 1-chloro-2-(phenylmethyl)-
- 1-Benzyl-2-Chlorobenzene
Sort by
Found 4 products.
2-Chlorodiphenylmethane
CAS:2-Chlorodiphenylmethane is a reactive chlorinating agent that can be used to chlorinate organic compounds. It reacts with diphenylmethane (CH) to form a trifluoroacetic acid derivative, which can then be recycled for further use. The reaction time of 2-chlorodiphenylmethane depends on the substituent effects of the reactants and the acid catalyst used. In liquid phase reactions, magnesium chloride is commonly used as an acid catalyst. This reagent is also reactive with chlorine gas in the presence of a base, producing hypochlorous acid.Formula:C13H11ClPurity:Min. 95%Molecular weight:202.68 g/mol