CAS 30132-23-1: ethyl 3-bromo-2-oxocyclohexanecarboxylate
Formula:C9H13BrO3
InChI:InChI=1S/C9H13BrO3/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h6-7H,2-5H2,1H3
InChI key:InChIKey=VKCMWLOBUILIOQ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CCCC(C1=O)Br
Sort by
Found 4 products.
Cyclohexanecarboxylicacid, 3-bromo-2-oxo-, ethyl ester
CAS:Formula:C9H13BrO3Purity:95%Color and Shape:LiquidMolecular weight:249.1017Ethyl 3-bromo-2-oxocyclohexanecarboxylate
CAS:3-Bromo-2-oxocyclohexanecarboxylate is a diterpene alkaloid that has been prepared by the Friedel-Crafts reaction of ethyl bromoacetate and cyclohexane. The product is an intramolecular arylation, which means that the two carbons in the ring are bonded to each other. This type of reaction usually produces a group specific functional group, such as an acid chloride or ester, but in this case it produces an alcohol. 3-Bromo-2-oxocyclohexanecarboxylate is used as a precursor for silver salts which are used to make photographic film.Formula:C9H13BrO3Purity:Min. 95%Molecular weight:249.1 g/molEthyl 3-bromo-2-oxocyclohexanecarboxylate
CAS:Ethyl 3-bromo-2-oxocyclohexanecarboxylatePurity:95%Molecular weight:249.10g/mol
