
CAS 30163-82-7: 3-(2-methyl-1H-benzimidazol-1-yl)propanoic acid
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c1-8-12-9-4-2-3-5-10(9)13(8)7-6-11(14)15/h2-5H,6-7H2,1H3,(H,14,15)
SMILES:Cc1nc2ccccc2n1CCC(=O)O
Synonyms:- 1H-Benzimidazole-1-propanoic acid, 2-methyl-
- 3-(2-methyl-1H-1,3-benzodiazol-1-yl)propanoic acid
- 3-(2-Methyl-1H-benzimidazol-1-yl)propanoic acid
Sort by
Found 2 products.
3-(2-Methyl-benzoimidazol-1-yl)-propionic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:204.229003906253-(2-Methyl-1H-benzimidazol-1-yl)propanoic acid
CAS:3-(2-Methyl-1H-benzimidazol-1-yl)propanoic acid is a heterocyclic compound that has potential antimicrobial properties. It has been shown to have antimicrobial activity against bacteria and fungi, but not against viruses. 3-(2-Methyl-1H-benzimidazol-1-yl)propanoic acid is converted to the corresponding hydrazide by reaction with hydrazine hydrate in water at pH 3. The hydrazide reacts with acetoacetate or ethyl acetoacetate in a cyclocondensation reaction to form the corresponding semicarbazide. The semicarbazides can then be hydrolyzed to release the original amine or alkylated with an alkylating agent such as thiolactic acid, benzimidazole derivative, oxadiazole, or aldehyde.Formula:C11H12N2O2Purity:Min. 95%Molecular weight:204.23 g/molRef: 3D-FM116591
Discontinued product