
CAS 3020-09-5: Robinetinidin
Formula:C15H11O6·Cl
InChI:InChI=1S/C15H10O6.ClH/c16-9-2-1-7-3-12(19)15(21-13(7)6-9)8-4-10(17)14(20)11(18)5-8;/h1-6H,(H4-,16,17,18,19,20);1H
InChI key:InChIKey=SSFSVCKWRJIXDS-UHFFFAOYSA-N
SMILES:OC=1C(=[O+]C2=C(C1)C=CC(O)=C2)C3=CC(O)=C(O)C(O)=C3.[Cl-]
Synonyms:- 1-Benzopyrylium, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride
- 1-Benzopyrylium, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)
- 3,3′,4′,5′,7-Pentahydroxyflavylium chloride
- 3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chromeniumchlorid
- Flavylium, 3,3′,4′,5′,7-pentahydroxy-, chloride
- Robinetinidin
- Robinetinidin chloride
- Robinetinidol chloride
- 3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride
Sort by
Found 3 products.
Robinetinidin chloride
CAS:Robinetinidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H11O6ClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:322.68Robinetinidin chloride
CAS:Robinetinidin chloride is a natural product for research related to life sciences. The catalog number is TN6622 and the CAS number is 3020-09-5.Formula:C15H11ClO6Purity:98%Color and Shape:SolidMolecular weight:322.7Robinetinidin chloride
CAS:Robinetinidin chloride is a type of flavonoid compound, specifically an anthocyanidin, which is derived from natural plant sources. This compound is primarily extracted from the heartwood and bark of certain tree species, such as robinia, and is a product of the plant's secondary metabolism. The mode of action of Robinetinidin chloride involves its strong antioxidant properties. It achieves this by scavenging free radicals and providing protection against oxidative stress, which can cause cellular damage. Its antioxidant capacity is attributed to its ability to donate hydrogen atoms or electrons, neutralizing reactive oxygen species. In scientific research, Robinetinidin chloride is utilized extensively in studies investigating the effects of flavonoids on health and disease. It is used in pharmacological and biochemical assays to explore its potential benefits in mitigating oxidative stress-related conditions. Additionally, it serves as a reference standard in analytical methodologies to identify and quantify flavonoids within plant extracts. The study of Robinetinidin chloride is crucial for understanding the broader implications of flavonoids in nutrition and medicine, where its potent antioxidant activities are of particular interest.Formula:C15H11ClO6Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:322.7 g/mol