
CAS 31009-34-4: 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline
Formula:C11H7Cl2F17Si
InChI:InChI=1/C11H7Cl2F17Si/c1-31(12,13)3-2-4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)30/h2-3H2,1H3
SMILES:C[Si](CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(Cl)Cl
Synonyms:- 6-Fluoro-2-(Trifluoromethyl)Quinolin-4-Ol
- Dichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Methylsilane
Sort by
Found 4 products.
6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline
CAS:6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinolinePurity:97%Color and Shape:PowderMolecular weight:231.15g/mol6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:231.030726666-Fluoro-2-(trifluoromethyl)quinolin-4-ol
CAS:6-Fluoro-2-(trifluoromethyl)quinolin-4-ol is an intramolecular quinoline that is synthesized by acetonitrile and trimethylsilylacetamide. This compound has a molecular weight of 291.33, a proton affinity of -0.37, and a hydrogen bond acceptor count of 2. The 6-fluoro group in the molecule forms an intramolecular hydrogen bond with the 4-OH group at position 2, which stabilizes the quinoline ring. The intramolecular hydrogen bond is also stabilized by the presence of the methyl group at position 6, which acts as a hydrogen bond donor to form a dimer. This compound has been found to have solvates with water or methanol and can exist as either cations or anions in solution depending on pH. The crystal structure of this compound was determined using X-ray diffraction analysis to be monFormula:C10H5F4NOPurity:Min. 95%Molecular weight:231.15 g/mol4-Quinolinol, 6-fluoro-2-(trifluoromethyl)-
CAS:Formula:C10H5F4NOPurity:98%Color and Shape:SolidMolecular weight:231.1464