
CAS 3163-07-3: 4-nitroresorcinol
Formula:C6H5NO4
InChI:InChI=1/C6H5NO4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,8-9H
InChI key:InChIKey=CYEZXDVLBGFROE-UHFFFAOYSA-N
SMILES:c1cc(c(cc1O)O)N(=O)=O
Synonyms:- 1,3-Benzenediol, 4-nitro-
- 4-Nitro-1,3-benzenediol
- 4-Nitro-3-hydroxyphenol
- 4-Nitrobenzene-1,3-Diol
- 4-Nitroresorcin
- 5-Hydroxy-2-nitrophenol
- Resorcinol, 4-nitro-
- 4-Nitroresorcinol
Sort by
Found 4 products.
Ref: IN-DA0039ZR
1g29.00€5g52.00€10g63.00€15g91.00€25g121.00€50g184.00€75g196.00€100g227.00€250mg25.00€4-Nitrobenzene-1,3-diol
CAS:4-Nitrobenzene-1,3-diolFormula:C6H5NO4Purity:95%Color and Shape: yellow solidMolecular weight:155.11g/mol4-Nitroresorcinol
CAS:4-Nitroresorcinol is a hydroxamic acid that inhibits bacterial growth by reacting with riboflavin, which is essential for the synthesis of flavoproteins and folate. This compound has been shown to have a specific growth rate on the order of 10^-5 and 10^-6 M. The reaction of 4-Nitroresorcinol with riboflavin leads to the production of nitric oxide and hydrogen peroxide, which can lead to the destruction of cells. 4-Nitroresorcinol has been synthesized in an organic solvent using various techniques such as thermal decomposition, photochemical synthesis, and hydrolysis. 4-Nitroresorcinol can be viewed under a microscope using techniques such as electron microscopy or light microscopy.Formula:C6H5NO4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:155.11 g/mol