CAS 31737-09-4: 6-chloro-1-methylpyrimidine-2,4(1H,3H)-dione
Formula:C5H5ClN2O2
InChI:InChI=1/C5H5ClN2O2/c1-8-3(6)2-4(9)7-5(8)10/h2H,1H3,(H,7,9,10)
SMILES:Cn1c(cc(nc1=O)O)Cl
Sort by
Found 6 products.
6-Chloro-1-methylpyrimidine-2,4(1H,3H)-dione
CAS:6-Chloro-1-methylpyrimidine-2,4(1H,3H)-dionePurity:95%Molecular weight:160.56g/mol6-Chloro-1-methyluracil
CAS:6-Chloro-1-methyluracil is a nucleophilic acylating agent that reacts with primary amines to form N,N'-acylureas. It also reacts with chloride to form chlorinated derivatives. 6-Chloro-1-methyluracil has been shown to react with hydrogen peroxide in an acid solution to produce cyclen and aldehydes. The reaction scheme is shown below: 6CUA + HO → 6CDH + HCHO The mechanism of the reaction is as follows: 6CUA + HO → 6CDH + HCl → 8CDH + ClO2 → 8CDH2OFormula:C5H5ClN2O2Purity:Min. 95%Molecular weight:160.56 g/mol6-Chloro-1-methylpyrimidine-2,4(1H,3H)-dione
CAS:6-Chloro-1-methylpyrimidine-2,4(1H,3H)-dione is a useful organic compound for research related to life sciences. The catalog number is T67201 and the CAS number is 31737-09-4.Formula:C5H5ClN2O2Color and Shape:SolidMolecular weight:160.566-CHLORO-1-METHYLPYRIMIDINE-2,4(1H,3H)-DIONE
CAS:Purity:95.0%Color and Shape:Liquid, No data available.Molecular weight:160.559997558593756-CHLORO-1-METHYLURACIL
CAS:Formula:C5H5ClN2O2Purity:98%Color and Shape:SolidMolecular weight:160.5584
