![thiazolo[5,4-b]pyridin-2-amine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F133393-thiazolo-54-b-pyridin-2-amine.webp&w=3840&q=75)
CAS 31784-70-0: thiazolo[5,4-b]pyridin-2-amine
Formula:C6H5N3S
InChI:InChI=1/C6H5N3S/c7-6-9-4-2-1-3-8-5(4)10-6/h1-3H,(H2,7,9)
SMILES:c1cc2c(nc1)sc(=N)[nH]2
Synonyms:- [1,3]Thiazolo[5,4-b]pyridin-2-amine
- Thiazolo[5,4-b]pyridin-2-amine
Sort by
Found 3 products.
2-Aminothiazolo[5,4-b]pyridine
CAS:2-Aminothiazolo[5,4-b]pyridine is an isothiocyanate that has potent antiproliferative and anticancer effects. It causes the inhibition of tumor growth by inhibiting the activity of enzymes such as DNA polymerase or topoisomerase II. 2-Aminothiazolo[5,4-b]pyridine also inhibits the proliferation of cancer cells and induces apoptosis. The anticancer effects are due to its ability to inhibit tumor cell growth and induce apoptosis in cancer cells.Formula:C6H5N3SPurity:Min. 95%Molecular weight:151.19 g/molThiazolo[5,4-b]pyridin-2-amine
CAS:Formula:C6H5N3SPurity:95%Color and Shape:SolidMolecular weight:151.1892-Aminothiazolo[5,4-b]pyridine
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:151.19000244140625