
CAS 31823-05-9: 1-benzofuran-5-ylmethanol
Formula:C9H8O2
InChI:InChI=1/C9H8O2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,10H,6H2
SMILES:c1cc2c(cco2)cc1CO
Synonyms:- 5-Benzofuranmethanol
- 1-BENZOFURAN-5-YLMETHANOL
Sort by
Found 5 products.
Benzofuran-5-ylmethanol
CAS:Benzofuran-5-ylmethanol is an aromatic ether that finds applications in various industries such as research chemicals, medicines, and catalysts. It is used as a building block for the synthesis of compounds like oxalyl glycine, aldehyde dimers, and trifluoroacetic acid. Benzofuran-5-ylmethanol also exhibits antiviral properties and has been studied for its potential in inhibiting viral replication. Additionally, it is a precursor for the synthesis of phenylethylamine derivatives and polyunsaturated fatty acids. With its diverse range of applications, Benzofuran-5-ylmethanol serves as a valuable compound in the field of organic chemistry and industrial processes.Formula:C9H8O2Purity:Min. 95%Molecular weight:148.16 g/molBenzofuran-5-ylmethanol
CAS:Benzofuran-5-ylmethanolPurity:98%Color and Shape:SolidMolecular weight:148.16g/mol1-Benzofuran-5-ylmethanol
CAS:Controlled ProductFormula:C9H8O2Color and Shape:NeatMolecular weight:148.159