
CAS 319906-45-1: 2-Bromo-7-iodo-9,9-dimethylfluorene
Formula:C15H12BrI
InChI:InChI=1/C15H12BrI/c1-15(2)13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)15/h3-8H,1-2H3
SMILES:CC1(C)c2cc(ccc2c2ccc(cc12)I)Br
Synonyms:- 2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene
- 7-Bromo-2-Iodo-9,9-Dimethyl-9H-Fluorene
Sort by
Found 4 products.
7-Bromo-2-iodo-9,9-dimethyl-9H-fluorene
CAS:Formula:C15H12BrIPurity:95%Color and Shape:SolidMolecular weight:399.06422-Bromo-7-iodo-9,9-dimethyl-9H-fluorene
CAS:2-Bromo-7-iodo-9,9-dimethyl-9H-fluorenePurity:99%Molecular weight:399.07g/mol2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene
CAS:2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene is a chemical compound that is used as a sensor for electron transfer in organic molecules. When the molecule is oxidized, the bromine atom is reduced to hydrogen bromide, which is able to conduct electricity. This allows it to be used as a sensing electrode to measure electron transfer in organic molecules. 2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene has been synthesized using experimental techniques and geometry experiments. The transport of electrons can be measured using electrodes with tripodal geometry with nanoscale dimensions.Formula:C15H12BrIPurity:95%NmrMolecular weight:399.06 g/mol