
CAS 32019-08-2: 2-(4-bromophenoxy)propanoic acid
Formula:C9H9BrO3
InChI:InChI=1/C9H9BrO3/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12)
SMILES:CC(C(=O)O)Oc1ccc(cc1)Br
Synonyms:- Propanoic Acid, 2-(4-Bromophenoxy)-
Sort by
Found 4 products.
2-(4-Bromophenoxy)propanoic acid
CAS:2-(4-Bromophenoxy)propanoic acid is a chiral selector that can be used to regulate the stereoselectivity (the relationship between the three-dimensional configuration of atoms in a molecule and its biological activity) of certain chemical reactions. 2-(4-Bromophenoxy)propanoic acid is an organic compound with a carboxylic group attached to a propionic acid. It is also known as 2-bromopropionate. It has been shown that 2-(4-Bromophenoxy)propanoic acid can be used to regulate the stereoselectivity of certain chemical reactions, such as the addition of phenyl boronic acids onto cyclohexenones or the conversion of carboxylic acid derivatives into amino acid derivatives. 2-(4-Bromophenoxy)propanoic acid has been used as a chiral selector in methanol, which allows for separation of enantiomers,Formula:C9H9BrO3Purity:Min. 95%Molecular weight:245.07 g/molRef: 3D-FB112704
Discontinued product2-(4-Bromophenoxy)propanoic acid
CAS:2-(4-Bromophenoxy)propanoic acidPurity:97%Molecular weight:245.07g/mol2-(4-bromophenoxy)propanoic acid
CAS:Purity:95.0%Color and Shape:Solid, CrystallineMolecular weight:245.07200622558594