CAS 3204-73-7: Hydroxyethoxybenzoicacidmethylester,98%
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-13-10(12)8-2-4-9(5-3-8)14-7-6-11/h2-5,11H,6-7H2,1H3
InChI key:InChIKey=VFBYWNSASHHPPA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(OCCO)C=C1
Synonyms:- 4-(2-Hydroxyethoxy)benzoic acid methyl ester
- 4-(2-Hydroxyethoxy)benzoic acid methyl ester,98%
- Benzoic acid, 4-(2-hydroxyethoxy)-, methyl ester
- Benzoic acid, p-(2-hydroxyethoxy)-, methyl ester
- Methyl 4-(2-Hydroxyethoxy)Benzoate
- Methyl 4-(β-hydroxyethoxy)benzoate
- Methyl p-(2-hydroxyethoxy)benzoate
- Methyl p-(β-hydroxyethoxy)benzoate
Sort by
Found 7 products.
Methyl 4-(2-Hydroxyethoxy)benzoate
CAS:Controlled ProductFormula:C10H12O4Color and Shape:NeatMolecular weight:196.20Methyl 4(2-hydroxyethoxy)benzoate
CAS:Methyl 4-(2-hydroxyethoxy)benzoate is an experimental monomer that can be used in the synthesis of polymers. It is a compound that has a spacer group on the 2 position of the benzene ring. It can be used to determine the molecular weight of polymers by comparing their average molecular weight with the theoretical molecular weight. The systematic name for methyl 4-(2-hydroxyethoxy)benzoate is methyl 4-[(2-hydroxyethoxy)methyl]benzoate. The chemical formula for this molecule is C 10 H 16 O 3 and its average molecular weight is 178. The theory behind this molecule is that it will have more than one polymer chain, which makes it polymeric.Formula:C10H12O4Purity:Min. 95%Molecular weight:196.2 g/molMethyl 4-(2-Hydroxyethoxy)benzoate
CAS:Formula:C10H12O4Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:196.204-(2-Hydroxyethoxy)benzoic acid methyl ester
CAS:4-(2-Hydroxyethoxy)benzoic acid methyl esterPurity:95Color and Shape:SolidMolecular weight:196.20g/mol
