
CAS 321704-27-2: N-Benzyl-2-bromobenzenesulfonamide
Formula:C13H12BrNO2S
InChI:InChI=1/C13H12BrNO2S/c14-12-8-4-5-9-13(12)18(16,17)15-10-11-6-2-1-3-7-11/h1-9,15H,10H2
SMILES:c1ccc(cc1)CNS(=O)(=O)c1ccccc1Br
Sort by
Found 3 products.
N-Benzyl-2-bromobenzenesulphonamide
CAS:N-Benzyl-2-bromobenzenesulphonamideMolecular weight:326.21g/molN-Benzyl-2-bromobenzenesulfonamide
CAS:N-Benzyl-2-bromobenzenesulfonamide is a versatile compound with various characteristics and applications. It exhibits analgesic activity, making it suitable for pain relief purposes. Additionally, it can be used as a heterocycle in the synthesis of other compounds or as a building block in chemical reactions. This compound has shown affinity for the adenosine A3 receptor, which plays a role in regulating inflammation and immune responses. Its interaction with this receptor suggests potential anti-inflammatory properties. N-Benzyl-2-bromobenzenesulfonamide also possesses herbicidal properties, making it effective against unwanted plant growth. It acts by inhibiting specific enzymes involved in plant metabolism. Furthermore, this compound has been studied for its interactions with hyaluronic acid, a key component of connective tissues. Its cationic nature allows it to form complexes with hyaluronic acid, potentially enhancing drug delivery systems or facilitating targeted therapies. In research settings, N-BenzFormula:C13H12BrNO2SPurity:Min. 95%Molecular weight:326.21 g/mol