CAS 32215-02-4: Aflatoxin P1
Formula:C16H10O6
InChI:InChI=1S/C16H10O6/c17-8-2-1-6-11-9(18)5-10-13(7-3-4-20-16(7)21-10)14(11)22-15(19)12(6)8/h3-5,7,16,18H,1-2H2/t7-,16+/m0/s1
InChI key:InChIKey=NRCXNPKDOMYPPJ-HYORBCNSSA-N
SMILES:OC=1C2=C(C=3[C@]4([C@@](OC3C1)(OC=C4)[H])[H])OC(=O)C5=C2CCC5=O
Synonyms:- (6aR,9aS)-2,3,6a,9a-Tetrahydro-4-hydroxycyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione
- (6aR,9aS)-4-hydroxy-2,3,6a,9a-tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene-1,11-dione
- AFP<sub>1</sub>
- Aflatoxin P<sub>1</sub>
- Cyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione, 2,3,6a,9a-tetrahydro-4-hydroxy-, (6aR,9aS)-
- Cyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione, 2,3,6a,9a-tetrahydro-4-hydroxy-, (6aR-cis)-
- Cyclopenta[c]furo[3′,2′:4,5]furo[2,3-h][1]benzopyran-1,11-dione, 2,3,6aα,9aα-tetrahydro-4-hydroxy-
- Aflatoxin P1
Sort by
Found 4 products.
Aflatoxin P1
CAS:Controlled ProductAflatoxin P1 is a mycotoxin that is produced by the fungus Aspergillus flavus. It has been shown to be hepatocarcinogenic in rats and may also have an effect on the immune system. Aflatoxin P1 binds to the nuclei of cells, preventing cell division and lysis. The binding of aflatoxins to DNA can lead to mutations in the gene sequence and alter gene expression. Aflatoxin P1 binds to proteins such as glucuronide conjugate, enzyme activities, and cell nuclei, which reduces its ability to bind with DNA. This toxin has also been shown to affect colony-stimulating factor production by inhibiting transcription-polymerase chain reactions. The binding of aflatoxins to DNA can lead to mutations in the gene sequence and alter gene expression. Aflatoxin P1 binds to proteins such as glucuronide conjugate, enzyme activities, and cell nuclei, which reduces its ability toFormula:C16H10O6Purity:Min. 95%Color and Shape:PowderMolecular weight:298.25 g/mol
