
CAS 32399-08-9: 2-Methylaminopyridine-3-carbaldehyde
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c1-8-7-6(5-10)3-2-4-9-7/h2-5H,1H3,(H,8,9)
SMILES:CNc1c(cccn1)C=O
Synonyms:- 2-(Methylamino)nicotinaldehyde
Sort by
Found 4 products.
2-(Methylamino)nicotinaldehyde
CAS:2-(Methylamino)nicotinaldehyde is a carboxylic acid that is the product of the reaction between methylamine and 2-nitropropene. It can be hydrolyzed to form methylimine, which can undergo ring-opening to form 2-(methylamino)acetonitrile. 2-(Methylamino)nicotinaldehyde reacts with sodium hydroxide to form a salt, which can then be brominated to form 2-(methylamino)-2'-bromonicotinic acid. The yields of this compound are around 30%.Formula:C7H8N2OPurity:Min. 95%Molecular weight:136.15 g/molRef: 3D-FM149916
Discontinued product2-(Methylamino)nicotinaldehyde
CAS:2-(Methylamino)nicotinaldehydePurity:95+%Color and Shape:LiquidMolecular weight:136.15g/mol