
CAS 324-03-8: 6-fluoro-1H-indole-2,3-dione
Formula:C8H4FNO2
InChI:InChI=1/C8H4FNO2/c9-4-1-2-5-6(3-4)10-8(12)7(5)11/h1-3H,(H,10,11,12)
SMILES:c1cc2c(cc1F)NC(=O)C2=O
Synonyms:- 1H-indole-2,3-dione, 6-fluoro-
- 6-Fluoroisatine
- 6-Fluoroisatin
- 6-Fluoroindoline-2,3-Dione
- 6-Fluoro-1H-indole-2,3-dione
Sort by
Found 5 products.
6-Fluoroisatin
CAS:6-Fluoroisatin is a fluorescent probe that binds to specific DNA and RNA sequences. 6-Fluoroisatin has been shown to bind to both DNA and RNA with high affinity, and has been used as a reagent for the detection of these nucleic acids. The fluoro group in 6-fluoroisatin allows for positron emission by converting fluorine into positrons when it is irradiated by electrons. This reaction can be used to detect specific dna or RNA sequences in a receptor binding assay. 6-Fluoroisatin also reacts with carbonyl groups and other electron rich molecules, which makes it useful as an additive in the study of reactivity.Formula:C8H4FNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:165.12 g/mol6-Fluoroindoline-2,3-dione
CAS:Formula:C8H4FNO2Purity:97%Color and Shape:SolidMolecular weight:165.1213