![N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F298840-n-5s-5-amino-5-carboxypentanoyl-l-cysteinyl-d-valine.webp&w=3840&q=75)
CAS 32467-88-2: N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
Formula:C14H25N3O6S
InChI:InChI=1/C14H25N3O6S/c1-7(2)11(14(22)23)17-12(19)9(6-24)16-10(18)5-3-4-8(15)13(20)21/h7-9,11,24H,3-6,15H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)(H,22,23)/t8-,9-,11+/m0/s1
Synonyms:- d-(L-a-Aminoadipyl)-L-cysteinyl-D-valine
- D-valine, N-[(5S)-5-amino-5-carboxy-1-oxopentyl]-L-cysteinyl-
- N-[N-(L-5-Amino-5-carboxyvaleryl)-L-cysteinyl]-D-valine
Sort by
Found 5 products.
Acv tripeptide
CAS:Acv tripeptide is a crucial precursor in penicillin and cephalosporin biosyntheses.Formula:C14H25N3O6SPurity:98%Color and Shape:SolidMolecular weight:363.43ACV trifluoroacetate salt
CAS:ACV trifluoroacetate salt H-Aad (Cys-D-Val-OH)-OH trifluoroacetate salt is a nonheme iron that has been shown to be an oxidizing agent. It is used in the synthesis of antibiotics and other organic compounds. ACV trifluoroacetate salt H-Aad (Cys-D-Val-OH)-OH trifluoroacetate salt also has synthetase activity, which catalyzes the formation of a thiolate ligand from two molecules of acetyl coenzyme A (ACCOA) and one molecule of propionyl coenzyme A (PCCOA). This ligand binds to metal ions such as Fe2+, which are then reduced to Fe3+ by the metal cluster. The water ligands on the coordination sphere may be replaced by other ligands, such as lysine.Formula:C14H25N3O6SPurity:Min. 95%Molecular weight:363.43 g/molACV
CAS:ACV is the key intermediate in the biosynthesis of all penicillin and cephalosporin antibiotics by eukaryotic and prokaryotic microorganisms.Formula:C14H25N3O6SPurity:97.9%Color and Shape:WhiteMolecular weight:363.44
