
CAS 32483-15-1: Ac-Leu-NHMe
Formula:C9H18N2O2
InChI:InChI=1/C9H18N2O2/c1-6(2)5-8(9(13)10-4)11-7(3)12/h6,8H,5H2,1-4H3,(H,10,13)(H,11,12)/t8-/m0/s1
SMILES:CC(C)C[C@@H](C(=NC)O)N=C(C)O
Synonyms:- N~2~-acetyl-N-methyl-L-leucinamide
Sort by
Found 4 products.
Ac-Leu-NHMe
CAS:Ac-Leu-NHMe is a hydrogen bond donor and is hydrated. The solute molecule has a molecular response to a change in water concentration. This solute is an amide with an intramolecular hydrogen bond between the carbonyl group and the nitrogen atom of the amide group. The nmr spectrum displays hydration, which can be seen by the presence of a water molecule as well as other solutes such as chloride ions, sodium ions, and potassium ions.Formula:C9H18N2O2Purity:Min. 95%Molecular weight:186.25 g/molRef: 3D-FA111814
Discontinued product