![1-(2-fluoroethyl)-1-nitroso-3-[4-(propan-2-yl)cyclohexyl]urea](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F57626-1-2-fluoroethyl-1-nitroso-3-4-propan-2-yl-cyclohexyl-urea.webp&w=3840&q=75)
CAS 33024-38-3: 1-(2-fluoroethyl)-1-nitroso-3-[4-(propan-2-yl)cyclohexyl]urea
Formula:C12H22FN3O2
InChI:InChI=1/C12H22FN3O2/c1-9(2)10-3-5-11(6-4-10)14-12(17)16(15-18)8-7-13/h9-11H,3-8H2,1-2H3,(H,14,17)
SMILES:CC(C)C1CCC(CC1)N=C(N(CCF)N=O)O
Synonyms:- 1-(2-Fluoroethyl)-3-(4-isopropylcyclohexyl)-1-nitrosourea
- urea, N-(2-fluoroethyl)-N'-[4-(1-methylethyl)cyclohexyl]-N-nitroso-
Sort by
Found 1 products.
1-(2-Fluoroethyl)-1-Nitroso-3-(4-Propan-2-Ylcyclohexyl)Urea
CAS:The compound 1-(2-fluoroethyl)-1-nitroso-3-(4-propan-2-ylcyclohexyl)urea is a quinolizidine alkaloid. The conformational and stereochemical properties of the molecule are determined by the stereoisomers, which are a result of the isomerization of the sulfate group. The molecule has a dipole moment due to its molecular structure, which allows it to be used as a catalyst for organic reactions. This compound also absorbs light at wavelengths of 260 nm and 285 nm. The thermal isomerization reaction can be catalyzed by copper chromite.Formula:C12H22FN3O2Purity:Min. 95%Molecular weight:259.32 g/mol