![2-azabicyclo[2.2.2]octan-3-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F133449-2-azabicyclo-2-2-2-octan-3-one.webp&w=3840&q=75)
CAS 3306-69-2: 2-azabicyclo[2.2.2]octan-3-one
Formula:C7H11NO
InChI:InChI=1/C7H11NO/c9-7-5-1-3-6(8-7)4-2-5/h5-6H,1-4H2,(H,8,9)
SMILES:C1CC2CCC1C(=N2)O
Sort by
Found 5 products.
2-Azabicyclo[2.2.2]octan-3-one
CAS:Controlled ProductApplications 2-Azabicyclo[2.2.2]octan-3-one (cas# 3306-69-2) is a useful research chemical.Formula:C7H11NOColor and Shape:NeatMolecular weight:125.172-Azabicyclo[2.2.2]octan-3-one
CAS:2-Azabicyclo[2.2.2]octan-3-one is a cyclic molecule that has a protonated form and a deprotonated form. The protonation of the ring nitrogen atom leads to conformational changes in the molecule, which are observed as changes in the magnetic properties of 2-azabicyclo[2.2.2]octan-3-one. These changes occur in the frequency range from 1 to 10 GHz, with a constant that depends on the solvent used for measurements (acetonitrile) and on the dilution factor of 2-azabicyclo[2.2.2]octan-3-oneFormula:C7H11NOPurity:Min. 95%Molecular weight:125.17 g/mol2-Azabicyclo[2.2.2]octan-3-one
CAS:2-Azabicyclo[2.2.2]octan-3-onePurity:95%Molecular weight:125.17g/mol2-azabicyclo[2.2.2]octan-3-one
CAS:Formula:C7H11NOPurity:97%Color and Shape:SolidMolecular weight:125.16832-Azabicyclo[2.2.2]octan-3-one
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:125.1709976196289