CAS 332154-57-1: (4-Chlorocarbonylphenyl)boronic anhydride
Formula:C7H4BClO2
InChI:InChI=1/C7H4BClO2/c9-7(10)5-1-3-6(8-11)4-2-5/h1-4H
SMILES:c1cc(ccc1C(=O)Cl)[BH]=O
Synonyms:- 4-Chlorocarbonylphenylboronic anhydride
- 4-(Oxoboranyl)Benzoyl Chloride
Sort by
Found 5 products.
Benzoylchloride-4-boronic acid
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:184.3800048828125(4-CHLOROCARBONYLPHENYL)BORONIC ANHYDRIDE
CAS:Formula:C7H6BClO3Purity:97%Color and Shape:SolidMolecular weight:184.3847(4-Chlorocarbonylphenyl)boronic acid
CAS:(4-Chlorocarbonylphenyl)boronic acid is a boronic acid that has been modified with a chloride group in the 4-position. This molecule is used as a sensor for hyperglycemia and can be used to detect changes in the concentration of glucose in bodily fluids. The dehydrogenase activity of this molecule has been shown to be increased by amide, chloride, ester, and lactam linkages. Hyperglycemia causes an increase in the production of reactive oxygen species (ROS) which may activate inflammatory pathways by activating nuclear factor kappa B (NFκB). The presence of ROS can lead to oxidative stress and inflammation.Formula:C7H6BClO3Purity:Min. 95%Molecular weight:184.38 g/mol(4-Chlorocarbonylphenyl)boronic acid
CAS:(4-Chlorocarbonylphenyl)boronic acidFormula:C7H6BClO3Purity:By hplc: 97.6% by area (Typical Value in Batch COA)Color and Shape: faint grey powderMolecular weight:184.38g/mol
