
CAS 33718-15-9: 1-bromo-8-fluoronaphthalene
Formula:C10H6BrF
InChI:InChI=1/C10H6BrF/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H
SMILES:c1cc2cccc(c2c(c1)Br)F
Synonyms:- Naphthalene, 1-Bromo-8-Fluoro-
Sort by
Found 4 products.
1-Bromo-8-fluoronaphthalene
CAS:1-Bromo-8-fluoronaphthalene is a versatile compound that has various applications in the field of research and medicine. It is commonly used as a building block for the synthesis of different compounds, including misoprostol, a medication used to prevent stomach ulcers. Additionally, 1-Bromo-8-fluoronaphthalene has been found to enhance the growth factor effect of allopregnanolone, a neurosteroid with potential therapeutic benefits. In research settings, this compound can be utilized as an electrode material due to its excellent conductivity properties. Moreover, 1-Bromo-8-fluoronaphthalene has shown promise in promoting collagen synthesis, making it valuable for tissue engineering applications. As a research chemical, 1-Bromo-8-fluoronaphthalene is widely used by scientists studying various fields such as organic chemistry and medicinal chemistry. Its unique structure and properties make it an essential component in the development of new drugs and therapeutic agentsFormula:C10H6BrFPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:225.06 g/molNaphthalene,1-bromo-8-fluoro-
CAS:Formula:C10H6BrFPurity:98%Color and Shape:SolidMolecular weight:225.05704319999998