CAS 33879-32-2: (2S)-2-amino-3-(3-methoxyphenyl)propanoic acid
Formula:C10H13NO3
InChI:InChI=1/C10H13NO3/c1-14-8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m0/s1
SMILES:COc1cccc(c1)C[C@@H](C(=O)O)N
Synonyms:- 3-Methoxy-L-phenylalanine
- L-phenylalanine, 3-methoxy-
Sort by
Found 6 products.
(2S)-2-amino-3-(3-methoxyphenyl)propanoic acid
CAS:(2S)-2-amino-3-(3-methoxyphenyl)propanoic acidPurity:97%Molecular weight:195.22g/mol(S)-2-Amino-3-(3-methoxyphenyl)propionic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:195.21800231933594(S)-2-Amino-3-(3-methoxyphenyl)propanoic acid
CAS:Formula:C10H13NO3Purity:97%Color and Shape:SolidMolecular weight:195.21511999999998L-3-Methoxyphenylalanine
CAS:L-3-Methoxyphenylalanine (L-3MP) is a natural amino acid that is involved in the synthesis of various proteins. L-3MP has shown to have a conformationally activating effect on the intestinal absorption of other amino acids, such as glycine and lysine. It also can be deacylated by pancreatic enzymes to form 3-methoxytyrosine (3MT), which may play a role in regulating insulin secretion. L-3MP has been investigated for possible use as an adjuvant therapy for pancreatic cancer.Formula:C10H13NO3Purity:Min. 95%Molecular weight:195.22 g/molRef: 3D-FM48380
Discontinued product
