CymitQuimica logo

CAS 33889-70-2: 4-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]naphtho[2,3-b]furan-7(8H)-one

Formula:C17H16O4
InChI:InChI=1/C17H16O4/c1-10(2)15(19)9-21-17-13-4-3-12(18)7-11(13)8-16-14(17)5-6-20-16/h3-6,8,15,19H,1,7,9H2,2H3
SMILES:C=C(C)C(COc1c2C=CC(=O)Cc2cc2c1cco2)O
Sort by

Found 1 products.
  • Pabulenol

    CAS:
    Pabulenol is an innovative biopolymer, which is synthesized from renewable plant-based resources through advanced biotechnological methods involving enzymatic polymerization. With its unique molecular structure, Pabulenol exhibits specific mode of action by facilitating biodegradation under ambient conditions, catalyzed by naturally occurring microbes. The polymer’s intrinsic ability to break down into non-toxic byproducts makes it an exceptional choice for sustainable environmental applications. Pabulenol finds extensive use across multiple domains, including agricultural, packaging, and environmental remediation sectors. In agriculture, it acts as a soil conditioner, enhancing nutrient availability and improving soil health. In packaging, its biodegradability addresses ecological concerns associated with traditional plastics. Moreover, it plays a crucial role in environmental remediation by assisting in the breakdown of organic pollutants. The versatility and ecological benefits of Pabulenol position it as a pivotal material in efforts to reduce environmental footprints and promote sustainability.
    Purity:Min. 95%

    Ref: 3D-FP74047

    ne
    To inquire