
CAS 33963-55-2: 2-(Methylsulfonyl)benzoic acid
Formula:C8H7O4S
InChI:InChI=1/C8H8O4S/c1-13(11,12)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)/p-1
SMILES:CS(=O)(=O)c1ccccc1C(=O)[O-]
Synonyms:- Benzoic acid, 2-(methylsulfonyl)-
- 2-(Methylsulfonyl)Benzoate
- 2-Methanesulfonyl-Benzoic Acid
Sort by
Found 4 products.
2-(Methylsulphonyl)benzoic acid
CAS:2-(Methylsulphonyl)benzoic acid (MSBA) is an inhibitor of nitrite reductase and hydrogen sulfide production in wastewater treatment. It has been shown to be effective against a number of bacteria, including typhimurium and pyocyanin-producing Pseudomonas aeruginosa. MSBA inhibits the growth of these bacteria by reacting with the carboxy terminal group on the enzymes involved in nitrite reduction and hydrogen sulfide production. MSBA also inhibits other enzyme activities, such as acetate hydrolysis, which can lead to corrosion of metal surfaces. In theory, MSBA may react with other compounds that contain hydroxyl groups to form a complex that is insoluble in water vapor or organic solvents. This reaction may result in potential interactions between MSBA and other drugs such as phenytoin or warfarin.Formula:C8H8O4SPurity:Min. 95%Molecular weight:200.21 g/mol2-(Methylsulphonyl)benzoic acid
CAS:2-(Methylsulphonyl)benzoic acidPurity:95Molecular weight:200.21g/mol2-(Methylsulfonyl)benzoic acid
CAS:Formula:C8H8O4SPurity:97%Color and Shape:SolidMolecular weight:200.21172-(Methylsulfonyl)benzoic acid
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:200.2100067138672