![(6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F2090-6as-11as-9-methoxy-6a-11a-dihydro-6h-1-benzofuro-32-c-chromen-3-ol.webp&w=3840&q=75)
CAS 33983-39-0: (6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-18-10-3-5-11-13-8-19-14-6-9(17)2-4-12(14)16(13)20-15(11)7-10/h2-7,13,16-17H,8H2,1H3/t13-,16-/m1/s1
SMILES:COc1ccc2[C@H]3COc4cc(ccc4[C@H]3Oc2c1)O
Synonyms:- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, cis-
- Medicarpin
Sort by
Found 4 products.
(+)-Medicarpin
CAS:(+)-Medicarpin, an isoflavonoid from plants like Sophora japonica, inhibits osteoclastogenesis and boosts bone mass via ERβ.Formula:C16H14O4Purity:97.8%Color and Shape:SolidMolecular weight:270.28Ref: TM-T13768
1mg138.00€5mg319.00€10mg434.00€25mg638.00€50mg860.00€100mg1,121.00€200mg1,501.00€1mL*10mM (DMSO)341.00€(+/-)-Medicarpin
CAS:(+/-)-Medicarpin is a natural isoflavonoid compound, which is derived from various leguminous plants, such as Medicago species. It functions as a phytoalexin, a type of antimicrobial and often antioxidative substance synthesized by plants as part of their defense mechanism against pathogens. The mode of action of (+/-)-Medicarpin involves disruption of the cellular processes of fungi, particularly by inhibiting the biosynthesis of ergosterol, a critical component of fungal cell membranes. This inhibition can lead to increased membrane permeability and subsequent cell death. (+/-)-Medicarpin has been extensively studied for its potential uses in agriculture and medicine. In agriculture, it serves as a natural fungicide to protect crops against fungal infections, thereby reducing the reliance on synthetic pesticides. In the medical field, its antifungal properties are being explored for therapeutic applications against pathogenic fungi affecting humans. Additionally, its role in modulating biological pathways has sparked interest in research on promoting bone health and possible anti-inflammatory effects. The multidisciplinary utility of (+/-)-Medicarpin underscores its significance in both academic research and practical applications.Formula:C16H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:270.28 g/mol