![rel-(6aR,11aR)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F1695-rel-6ar-11ar-6a-11a-dihydro-9-methoxy-6h-benzofuro-32-c-1-benzopyran-3-ol.webp&w=3840&q=75)
CAS 33983-40-3: rel-(6aR,11aR)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-18-10-3-5-11-13-8-19-14-6-9(17)2-4-12(14)16(13)20-15(11)7-10/h2-7,13,16-17H,8H2,1H3/t13-,16-/s2
InChI key:InChIKey=NSRJSISNDPOJOP-AYSIPDSENA-N
SMILES:OC=1C=C2C([C@@]3([C@@](C=4C(O3)=CC(OC)=CC4)(CO2)[H])[H])=CC1
Synonyms:- (±)-3-Demethylhomopterocarpin
- (±)-3-Hydroxy-9-methoxypterocarpan
- (±)-Demethylhomopterocarpin
- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-
- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, (6aR,11aR)-rel-
- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, cis-
- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6aβ,11aβ-dihydro-9-methoxy-, (±)-
- Medicarpin
- rel-(6aR,11aR)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol
Sort by
Found 1 products.
(+)-Medicarpin
CAS:(+)-Medicarpin is a natural phytoalexin, which is a type of compound produced by plants as part of their defense mechanism against pathogens. It is primarily derived from species within the Fabaceae family, such as Medicago and Glycyrrhiza. As a specialized metabolite, (+)-Medicarpin plays a crucial role in plant resistance, accumulating in response to biotic stress. Its mode of action involves the disruption of fungal cell membranes and the inhibition of microbial growth, making it an effective antifungal agent. Additionally, (+)-Medicarpin exhibits significant anti-inflammatory properties through the modulation of inflammatory pathways and the reduction of pro-inflammatory mediators. The uses and applications of (+)-Medicarpin are extensive in scientific research. It is studied for its potential in developing new antifungal therapies and elucidating plant defense mechanisms. Moreover, its anti-inflammatory action makes it a valuable compound in exploring treatments for inflammatory diseases. Ongoing research aims to further understand its molecular interactions and broaden its utility in pharmacological and agricultural industries.Purity:Min. 95%