
CAS 341010-40-0: 6-chloroquinolin-5-amine
Formula:C9H7ClN2
InChI:InChI=1/C9H7ClN2/c10-7-3-4-8-6(9(7)11)2-1-5-12-8/h1-5H,11H2
SMILES:c1cc2c(ccc(c2N)Cl)nc1
Sort by
Found 4 products.
6-CHLOROQUINOLIN-5-AMINE
CAS:Formula:C9H7ClN2Purity:98%Color and Shape:SolidMolecular weight:178.61836-Chloroquinolin-5-amine
CAS:6-Chloroquinolin-5-amine has been shown to inhibit the formation of epoxyeicosatrienoic acids and induce a decrease in nitrite levels. It also inhibits the production of adenosine, hydrogen peroxide, and nitric oxide. 6-Chloroquinolin-5-amine has been shown to have antioxidant effects in humans by decreasing the production of reactive oxygen species (ROS) and increasing blood flow. The drug does not affect methemoglobin levels or cause hemolysis. 6-Chloroquinolin-5-amine is sensitive to peroxide, but not as sensitive as other antioxidants such as vitamin C. Studies show that 6-chloroquinalin-5 amine may be useful for preventing nitrite toxicity in humans because it can inhibit the formation of nitric oxide synthase, reduce the amount of NO produced, and increase blood flow while not affecting methemoglobin levels or causing hemolysis.Purity:Min. 95%