
CAS 34232-16-1: Formononetin-7-O-β-D-glucoside-6"-O-malonate
Formula:C25H24O12
InChI:InChI=1S/C25H24O12/c1-33-13-4-2-12(3-5-13)16-10-34-17-8-14(6-7-15(17)21(16)29)36-25-24(32)23(31)22(30)18(37-25)11-35-20(28)9-19(26)27/h2-8,10,18,22-25,30-32H,9,11H2,1H3,(H,26,27)/t18-,22-,23+,24-,25-/m1/s1
InChI key:InChIKey=RDTAGQKYPGLCBK-GOZZSVHWSA-N
SMILES:O=C1C=2C(=CC(O[C@@H]3O[C@H](COC(CC(O)=O)=O)[C@@H](O)[C@H](O)[C@H]3O)=CC2)OC=C1C4=CC=C(OC)C=C4
Synonyms:- 7-[[6-O-(Carboxyacetyl)-β-D-glucopyranosyl]oxy]-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- Formononetin 7-O-β-D-glucoside 6′′-O-malonate
- Formononetin 7-O-glucoside-6′′-O-malonate
- Ononin, 6′-(hydrogen malonate)
- 4H-1-Benzopyran-4-one, 7-[[6-O-(carboxyacetyl)-β-D-glucopyranosyl]oxy]-3-(4-methoxyphenyl)-
Sort by
Found 3 products.
Formononetin 7-O-beta-D-Glucoside 6''-O-malonate
CAS:Controlled ProductFormula:C25H24O12Color and Shape:NeatMolecular weight:516.451Formononetin 7-O-glucoside-6''-O-malonate
CAS:Formononetin 7-O-glucoside-6''-O-malonate is a naturally occurring flavonoid compound, which is often derived from various plant sources, particularly those in the legume family. It is a malonylated glucoside derivative of formononetin, a well-known isoflavone. This compound plays a significant role in the plants' defense mechanisms and contributes to their physiological processes. The mode of action of Formononetin 7-O-glucoside-6''-O-malonate largely centers around its potential antioxidant and anti-inflammatory properties. By interacting with cellular pathways, it can modulate the activity of enzymes and receptors involved in oxidative stress and inflammation, thereby exhibiting potential protective effects against cellular damage. In scientific research, Formononetin 7-O-glucoside-6''-O-malonate is studied for its potential applications in promoting human health. Its antioxidant capabilities suggest a role in protecting cells from oxidative stress, while its anti-inflammatory properties may have implications in the management of inflammatory conditions. Further investigation is ongoing to fully elucidate its range of biological activities and potential therapeutic applications.Formula:C25H30O12Purity:Min. 95%Molecular weight:522.5 g/mol