
CAS 34232-17-2: 5-hydroxy-3-(4-methoxyphenyl)-4-oxo-4H-chromen-7-yl 6-O-(carboxyacetyl)-beta-D-glucopyranoside
Formula:C25H24O13
InChI:InChI=1S/C25H24O13/c1-34-12-4-2-11(3-5-12)14-9-35-16-7-13(6-15(26)20(16)21(14)30)37-25-24(33)23(32)22(31)17(38-25)10-36-19(29)8-18(27)28/h2-7,9,17,22-26,31-33H,8,10H2,1H3,(H,27,28)/t17-,22-,23+,24-,25-/m1/s1
InChI key:InChIKey=VRCBYTZZZFFKEN-RBZNUJCTSA-N
SMILES:O=C1C=2C(=CC(O[C@@H]3O[C@H](COC(CC(O)=O)=O)[C@@H](O)[C@H](O)[C@H]3O)=CC2O)OC=C1C4=CC=C(OC)C=C4
Synonyms:- 4H-1-Benzopyran-4-one, 7-[[6-O-(carboxyacetyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-3-(4-methoxyphenyl)-
- Biochanin A 7-O-glucoside 6′′-O-malonate
- Biochanin A 7-O-β-D-glucoside 6′′-O-malonate
- 7-[[6-O-(Carboxyacetyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- Isoflavone, 5,7-dihydroxy-4′-methoxy-, 7-β-D-glucopyranoside 6′-(hydrogen malonate)
- See more synonyms
Sort by
Found 3 products.
Biochanin A 7-O-glucoside 6''-O-malonate
CAS:Biochanin A 7-O-glucoside 6''-O-malonate is a naturally occurring isoflavone glycoside, which is a secondary metabolite commonly found in various plant species. This compound is primarily sourced from legumes such as red clover. Isoflavones and their derivatives are well-regarded for their ability to modulate estrogenic activity due to their structural similarity to endogenous estrogens. Biochanin A 7-O-glucoside 6''-O-malonate acts through various biochemical pathways, including binding to estrogen receptors and influencing gene expression related to hormonal regulation. The primary applications of this compound are in the field of biochemical research, where it is studied for its potential roles in reducing the risk of hormone-dependent diseases such as certain cancers. Additionally, its antioxidant properties lend it significance in studies focusing on oxidative stress and related pathologies. By understanding the intricate interactions of this compound, researchers aim to elucidate the mechanisms underlying its potential protective effects and therapeutic benefits. This makes Biochanin A 7-O-glucoside 6''-O-malonate a valuable focus within pharmacological and nutraceutical contexts.Formula:C25H24O13Purity:Min. 95%Molecular weight:532.4 g/molBiochanin A 7-O-beta-D-glucoside 6''-O-malonate
CAS:Controlled ProductFormula:C25H24O13Color and Shape:NeatMolecular weight:532.45