
CAS 343780-69-8: (3β,6α)-20-(β-D-Glucopyranosyloxy)-3,6-dihydroxydammar-24-en-12-one
Formula:C36H60O9
InChI:InChI=1S/C36H60O9/c1-19(2)10-9-13-36(8,45-31-29(43)28(42)27(41)23(18-37)44-31)20-11-15-34(6)26(20)21(38)16-24-33(5)14-12-25(40)32(3,4)30(33)22(39)17-35(24,34)7/h10,20,22-31,37,39-43H,9,11-18H2,1-8H3/t20-,22-,23+,24+,25-,26-,27+,28-,29+,30-,31-,33+,34+,35+,36-/m0/s1
InChI key:InChIKey=VGJOYFZLAIERID-CVQXJYBDSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])(C(=O)C[C@@]1([C@]5(C)[C@@]([C@@H](O)C2)(C(C)(C)[C@@H](O)CC5)[H])[H])[H]
Synonyms:- (3β,6α)-20-(β-D-Glucopyranosyloxy)-3,6-dihydroxydammar-24-en-12-one
- Dammar-24-en-12-one, 20-(β-D-glucopyranosyloxy)-3,6-dihydroxy-, (3β,6α)-
- Ginsenoside Rh8
Sort by
Found 3 products.
Ginsenoside Rh8
CAS:Ginsenoside Rh8 is a bioactive compound, which is a specific type of ginsenoside. It is derived from Panax ginseng, a medicinal plant revered in traditional Asian medicine. This compound belongs to the category of triterpenoid saponins, primarily responsible for the myriad pharmacological effects attributed to ginseng. Ginsenoside Rh8 is thought to exert its effects through modulation of various signaling pathways, including anti-inflammatory and antioxidant mechanisms, as well as modulation of cellular apoptosis. These interactions occur at the molecular level, where it influences cytokine production and reactive oxygen species scavenging. Researchers are keenly investigating Ginsenoside Rh8 for its potential therapeutic applications, particularly in oncology and neuroprotection. Studies suggest that it may inhibit tumor growth and enhance the efficacy of certain chemotherapeutic agents, owing to its ability to modulate apoptotic pathways. Additionally, its neuroprotective effects are being explored in the context of neurodegenerative diseases, such as Alzheimer's and Parkinson's disease, where cell death and inflammation are prevalent. While still under study, Ginsenoside Rh8 represents a promising avenue for the development of novel therapeutic strategies.Formula:C36H60O9Purity:Min. 95%Molecular weight:636.87 g/mol