
CAS 3457-45-2: 4-acetylbenzaldehyde
Formula:C9H8O2
InChI:InChI=1/C9H8O2/c1-7(11)9-4-2-8(6-10)3-5-9/h2-6H,1H3
SMILES:CC(=O)c1ccc(cc1)C=O
Synonyms:- Benzaldehyde, 4-Acetyl-
Sort by
Found 4 products.
4-Acetylbenzaldehyde
CAS:4-Acetylbenzaldehyde is a chemical compound that belongs to the group of organic compounds known as aldehydes. It is used to reduce other carbonyl compounds, such as triethyl orthoformate, with diborane or sodium borohydride. 4-Acetylbenzaldehyde is an efficient method for reducing carbonyl groups in organic molecules. It has been shown to be more effective than catalytic hydrogenation and less expensive than palladium-based reduction methods. This compound reduces chloride to formyl chloride and amide to amine. 4-Acetylbenzaldehyde has also been shown to have a catalytic effect on the reaction between phenol and potassium permanganate, which is important for synthesizing nitrophenols.Formula:CH3COC6H4CHOPurity:Min. 95%Molecular weight:148.16 g/mol