CAS 3460-04-6: Propanamide, 3-chloro-N-phenyl-
Formula:C9H10ClNO
InChI:InChI=1/C9H10ClNO/c10-7-6-9(12)11-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)
SMILES:c1ccc(cc1)N=C(CCCl)O
Synonyms:- 3-Chloro-N-phenylpropanamide
- 3-Chloro-N-phenylpropionamide
Sort by
Found 5 products.
3-Chloro-N-phenylpropanamide
CAS:3-Chloro-N-phenylpropanamide is an anticancer agent that inhibits the production of δ-receptors. It also prevents the activation of δ receptors, which are a subtype of opioid receptor. 3-Chloro-N-phenylpropanamide binds to the quinoline derivatives in δ receptors, thereby preventing their activation by other ligands and blocking their downstream effects. The synthesis of this compound involves reactions with phosphorus pentachloride and ammonium nitrate to form a chloropropanamide. This compound can be used in techniques such as hydrogen chloride gas cleavage and dimethylamine hydrochloride (DMH) hydrolysis.Formula:C9H10ClNOPurity:Min. 95%Molecular weight:183.63 g/mol3-Chloro-N-phenylpropanamide
CAS:Please enquire for more information about 3-Chloro-N-phenylpropanamide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C9H10ClNOPurity:Min. 95%Molecular weight:183.63 g/mol3-Chloro-N-phenylpropionamide
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:183.639999389648443-CHLORO-N-PHENYLPROPANAMIDE
CAS:Formula:C9H10ClNOPurity:97%Color and Shape:SolidMolecular weight:183.6348
