![bicyclo[4.2.0]octa-1,3,5-trien-7-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F305832-bicyclo-4-2-0-octa-135-trien-7-one.webp&w=3840&q=75)
CAS 3469-06-5: bicyclo[4.2.0]octa-1,3,5-trien-7-one
Formula:C8H6O
InChI:InChI=1/C8H6O/c9-8-5-6-3-1-2-4-7(6)8/h1-4H,5H2
SMILES:c1ccc2c(c1)CC2=O
Synonyms:- Benzocyclobutenone
Sort by
Found 4 products.
Benzocyclobuten-1(2h)-one
CAS:Benzocyclobuten-1(2h)-one is an alkanoic acid that has been shown to have anticancer activity. It can be synthesized by the reaction of sodium salts and benzoyl chloride in a solvent, such as dichloromethane. The synthesis is efficient and can be done in a short period of time. The product is purified by recrystallization, followed by washing with water. The reaction products are functional groups, which are characterized by their ability to react with other compounds or function as hydrogen acceptors. Benzocyclobuten-1(2h)-one has three nitrogen atoms and one carbonyl group.Formula:C8H6OPurity:Min. 95%Molecular weight:118.13 g/molRef: 3D-FB34084
Discontinued productBenzocyclobutenone
CAS:Formula:C8H6OPurity:96%Color and Shape:LiquidMolecular weight:118.13264000000002Benzocyclobutenone
CAS:BenzocyclobutenoneFormula:C8H6OPurity:96%Color and Shape: colourless liquidMolecular weight:118.13g/molBicyclo[4.2.0]octa-1,3,5-trien-7-one
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:118.13500213623047