CAS 3513-04-0: (3β,12β,14β,17α)-3,8,12,14,17-Pentahydroxypregn-5-en-20-one
Formula:C21H32O6
InChI:InChI=1S/C21H32O6/c1-12(22)19(25)8-9-21(27)18(19,3)16(24)11-15-17(2)6-5-14(23)10-13(17)4-7-20(15,21)26/h4,14-16,23-27H,5-11H2,1-3H3/t14-,15+,16+,17-,18+,19+,20-,21+/m0/s1
InChI key:InChIKey=ATMZVVNNICECKQ-MNSFQJRNSA-N
SMILES:O[C@@]12[C@@]3(O)[C@@]([C@]4(C)C(=CC3)C[C@@H](O)CC4)(C[C@@H](O)[C@]1(C)[C@@](C(C)=O)(O)CC2)[H]
Synonyms:- Deacylmetaplexigenin
- 14β,17α-Pregn-5-en-20-one, 3β,8,12β,14,17-pentahydroxy-
- (3β,12β,14β,17α)-3,8,12,14,17-Pentahydroxypregn-5-en-20-one
- Desacetylmetaplexigenin
- Pregn-5-en-20-one, 3,8,12,14,17-pentahydroxy-, (3β,12β,14β,17α)-
Sort by
Found 4 products.
Deacylmetaplexigenin
CAS:Deacylmetaplexigenin is a naturally occurring compound, which is a cardenolide derived from certain plant species. This bioactive molecule is primarily extracted from plants belonging to the Apocynaceae family. It operates by interacting with cellular pathways that regulate ion transport, particularly inhibiting sodium-potassium ATPase. This inhibition can lead to altered ion gradients across cell membranes, affecting cellular functions and signaling pathways. The unique mode of action of deacylmetaplexigenin makes it a subject of interest for studying cardiac glycosides in research focused on cardiac physiology and cancer biology. Its ability to influence ionic balance and cellular homeostasis allows researchers to explore its potential in modulating heart contractions and exerting cytotoxic effects against certain cancer cell lines. Consequently, deacylmetaplexigenin is utilized in experimental settings for its potential therapeutic implications, although its application remains largely exploratory within scientific research contexts.Formula:C21H32O6Purity:Min. 95%Molecular weight:380.5 g/molDeacylmetaplexigenin
CAS:Deacylmetaplexigenin is a pregnane glycoside isolated from Asclepias incarnate.Formula:C21H32O6Purity:98%Color and Shape:SolidMolecular weight:380.48
