
CAS 35213-56-0: 2-chloro-6-ethyl-4-methyl-quinoline
Formula:C12H12ClN
InChI:InChI=1/C12H12ClN/c1-3-9-4-5-11-10(7-9)8(2)6-12(13)14-11/h4-7H,3H2,1-2H3
SMILES:CCc1ccc2c(c1)c(C)cc(Cl)n2
Synonyms:- 2-Chloro-6-Ethyl-4-Methylquinoline
- Quinoline, 2-Chloro-6-Ethyl-4-Methyl-
Sort by
Found 2 products.
2-chloro-6-ethyl-4-methylquinoline
CAS:Purity:95.0%Color and Shape:Solid, Light brown powderMolecular weight:205.690002441406252-Chloro-6-ethyl-4-methylquinoline
CAS:2-Chloro-6-ethyl-4-methylquinoline is a chemical compound with the molecular formula CHClNCl. It is used as an intermediate in the production of other molecules, such as 2-chloro-6-ethylquinoline (CAS#1012-76-3) and 3,5,6,7,8,9,10-hexachloro-[1.2.2]octane (CAS#88603-97-3). 2CHEMQ has been shown to be active against various organisms including Bacillus subtilis and Escherichia coli. The structure of this molecule changes depending on environmental conditions due to the presence of tautomers.Formula:C12H12ClNPurity:Min. 95%Molecular weight:205.68 g/molRef: 3D-FC132990
Discontinued product