CAS 3526-43-0: 4-Methoxy-N-phenylbenzenemethanamine
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-10,15H,11H2,1H3
InChI key:InChIKey=WRDZMZGYHVUYRU-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)C2=CC=C(OC)C=C2
Synonyms:- Benzylamine, p-methoxy-N-phenyl-
- N-(4-Methoxybenzyl)aniline
- Benzenemethanamine, 4-methoxy-N-phenyl-
- 4-Methoxy-N-phenylbenzenemethanamine
- p-Methoxy-N-phenylbenzylamine
Sort by
Found 6 products.
N-(4-Methoxybenzyl)aniline
CAS:N-(4-Methoxybenzyl)aniline is a bifunctional amine that is used for the efficient synthesis of unsaturated ketones. The reaction mechanism begins with a protonation step, which leads to the formation of an iminium ion and a boronate ester. The iminium ion reacts with an electrophile (unsaturated ketone) to form an enamine, which is then hydrolyzed by water. This process can be repeated multiple times to create more complex molecules. N-(4-Methoxybenzyl)aniline has been shown to react efficiently in the presence of unsaturated ketones, such as 2-methylcyclohexanone and 3-penten-2-one. It also shows magnetic properties, making it suitable for use in magnetic nanoparticles.Formula:C14H15NOPurity:Min. 95%Molecular weight:213.28 g/molN-Phenyl-4-methoxybenzylamine
CAS:Controlled ProductApplications N-PHENYL-4-METHOXYBENZYLAMINE (cas# 3526-43-0) is a useful research chemical.Formula:C14H15NOColor and Shape:NeatMolecular weight:213.275N-(4-Methoxybenzyl)aniline
CAS:Formula:C14H15NOPurity:>95.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:213.28(4-METHOXY-BENZYL)-PHENYL-AMINE
CAS:Formula:C14H15NOPurity:97%Color and Shape:SolidMolecular weight:213.275
