
CAS 35276-81-4: 3-(2-methylphenyl)-3-oxopropanenitrile
Formula:C10H9NO
InChI:InChI=1/C10H9NO/c1-8-4-2-3-5-9(8)10(12)6-7-11/h2-5H,6H2,1H3
SMILES:Cc1ccccc1C(=O)CC#N
Synonyms:- Benzenepropanenitrile, 2-Methyl-Beta-Oxo-
Sort by
Found 4 products.
2-Methylbenzoylacetonitrile
CAS:2-Methylbenzoylacetonitrile is a reactive compound that can undergo cyclization and oxidation reactions. It can be used in the synthesis of other compounds, such as acetophenone. The postulated mechanism of this reaction is shown below: 2-methylbenzoylacetonitrile + tert-butyl hydroperoxide → 2-methylbenzoic acid + tert-butyl alcohol + hydrogen peroxide 2-methylbenzoic acid + thiourea → 2-methylbenzoyl amide 2-methylbenzoyl amide + methylene → 2-(2-methylphenyl)acetamide Hydroperoxide (HOOH) + methylene → acetic acid This reaction forms an acetic acid molecule and a methylene molecule.Formula:C10H9NOPurity:Min. 95%Molecular weight:159.18 g/mol3-(2-Methylphenyl)-3-oxopropanenitrile
CAS:3-(2-Methylphenyl)-3-oxopropanenitrilePurity:98%Molecular weight:159.18g/mol3-Oxo-3-(o-tolyl)propanenitrile
CAS:Formula:C10H9NOPurity:98%Color and Shape:SolidMolecular weight:159.1846