CAS 35927-38-9: Vicenin 1
Formula:C26H28O14
InChI:InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17+,18-,21+,22-,23-,25+,26+/m1/s1
InChI key:InChIKey=OVMFOVNOXASTPA-MCIQUCDDSA-N
SMILES:OC=1C(=C2C(=C(O)C1[C@H]3[C@H](O)[C@@H](O)[C@H](O)CO3)C(=O)C=C(O2)C4=CC=C(O)C=C4)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O
Synonyms:- 6-C-Xylosyl-8-C-glucosylapigenin
- Vitexin 1
- Vicenin 1
- 4H-1-Benzopyran-4-one, 8-β-D-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-6-β-D-xylopyranosyl-
- 8-β-D-Glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-6-β-D-xylopyranosyl-4H-1-benzopyran-4-one
Sort by
Found 4 products.
Vicenin-1
CAS:Vicenin-1 (Vicenin -1) is a flavonoid glycoside isolated from the seeds of the leguminous plant fenugreek with potent anti-inflammatory and antioxidant activityFormula:C26H28O14Purity:99.75%Color and Shape:SolidMolecular weight:564.49Vicenin-1
CAS:Vicenin-1 is a bioactive compound classified as a flavonoid glycoside, which is typically derived from plant sources such as herbs and certain fruits. With a unique mode of action, Vicenin-1 acts primarily as an antioxidant, scavenging free radicals and reactive oxygen species to mitigate oxidative stress within biological systems. This process is crucial in protecting cellular components from oxidative damage, which is often implicated in aging and various diseases. In the realm of scientific research, Vicenin-1 has garnered attention due to its potential therapeutic applications. It is explored for its anti-inflammatory, cardioprotective, and neuroprotective effects. Additionally, this compound is being studied for its role in modulating immune responses and its potential to enhance overall cellular resilience against environmental stressors. As a naturally occurring phytochemical, Vicenin-1 represents a significant interest for further investigation in the fields of nutraceuticals and pharmacology, particularly in the development of plant-derived therapeutic agents.Formula:C26H28O14Purity:Min. 95%Molecular weight:564.5 g/mol
