CAS 35969-51-8: 2-(2-ethoxy-2-oxoethyl)pyridine-3-carboxylic acid
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-2-15-9(12)6-8-7(10(13)14)4-3-5-11-8/h3-5H,2,6H2,1H3,(H,13,14)
SMILES:CCOC(=O)Cc1c(cccn1)C(=O)O
Sort by
Found 4 products.
2-(2-ETHOXY-2-OXOETHYL)NICOTINIC ACID
CAS:Formula:C10H11NO4Color and Shape:SolidMolecular weight:209.19862-(2-Ethoxy-2-oxoethyl)nicotinic acid
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:209.20100402832032-(2-Ethoxy-2-oxoethyl)nicotinic acid
CAS:2-(2-Ethoxy-2-oxoethyl)nicotinic acidFormula:C10H11NO4Purity:By hplc: 99.0% by area (225 nm) (Typical Value in Batch COA)Color and Shape:SolidMolecular weight:209.20g/mol2-(2-Ethoxy-2-oxoethyl)nicotinic acid
CAS:2-(2-Ethoxy-2-oxoethyl)nicotinic acid (EETN) belongs to the class of intramolecular reactions. It is a urethane that undergoes an intramolecular cyclization reaction with isocyanate and azide. The nucleophiles are then incorporated into the resulting azaindole ring, which can be cleaved by hydrolysis to release nicotinic acid or azaindole. EETN has been used as a target compound in the synthesis of various other compounds, such as nicotinic acid and azaindole.Formula:C10H11NO4Purity:Min. 95%Molecular weight:209.2 g/mol
